aboutsummaryrefslogtreecommitdiffstats
path: root/vendor/github.com/bsm/histogram/v3
diff options
context:
space:
mode:
authorDmitry Vyukov <dvyukov@google.com>2024-03-31 12:24:45 +0200
committerDmitry Vyukov <dvyukov@google.com>2024-04-09 07:55:50 +0000
commit73f4b622a34ffc998a542f5e109fb05a1d892272 (patch)
treee1b07bff6ea34c523ee7fd5c1ff2e614570f8c02 /vendor/github.com/bsm/histogram/v3
parent976a34ecfb3a3604c1e1c9532cb77809d14a7429 (diff)
go.mod: vendor github.com/bsm/histogram
Diffstat (limited to 'vendor/github.com/bsm/histogram/v3')
-rw-r--r--vendor/github.com/bsm/histogram/v3/.gitignore1
-rw-r--r--vendor/github.com/bsm/histogram/v3/LICENSE201
-rw-r--r--vendor/github.com/bsm/histogram/v3/Makefile10
-rw-r--r--vendor/github.com/bsm/histogram/v3/README.md14
-rw-r--r--vendor/github.com/bsm/histogram/v3/bins.go18
-rw-r--r--vendor/github.com/bsm/histogram/v3/histogram.go266
6 files changed, 510 insertions, 0 deletions
diff --git a/vendor/github.com/bsm/histogram/v3/.gitignore b/vendor/github.com/bsm/histogram/v3/.gitignore
new file mode 100644
index 000000000..48b8bf907
--- /dev/null
+++ b/vendor/github.com/bsm/histogram/v3/.gitignore
@@ -0,0 +1 @@
+vendor/
diff --git a/vendor/github.com/bsm/histogram/v3/LICENSE b/vendor/github.com/bsm/histogram/v3/LICENSE
new file mode 100644
index 000000000..1625b8474
--- /dev/null
+++ b/vendor/github.com/bsm/histogram/v3/LICENSE
@@ -0,0 +1,201 @@
+ Apache License
+ Version 2.0, January 2004
+ http://www.apache.org/licenses/
+
+ TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
+
+ 1. Definitions.
+
+ "License" shall mean the terms and conditions for use, reproduction,
+ and distribution as defined by Sections 1 through 9 of this document.
+
+ "Licensor" shall mean the copyright owner or entity authorized by
+ the copyright owner that is granting the License.
+
+ "Legal Entity" shall mean the union of the acting entity and all
+ other entities that control, are controlled by, or are under common
+ control with that entity. For the purposes of this definition,
+ "control" means (i) the power, direct or indirect, to cause the
+ direction or management of such entity, whether by contract or
+ otherwise, or (ii) ownership of fifty percent (50%) or more of the
+ outstanding shares, or (iii) beneficial ownership of such entity.
+
+ "You" (or "Your") shall mean an individual or Legal Entity
+ exercising permissions granted by this License.
+
+ "Source" form shall mean the preferred form for making modifications,
+ including but not limited to software source code, documentation
+ source, and configuration files.
+
+ "Object" form shall mean any form resulting from mechanical
+ transformation or translation of a Source form, including but
+ not limited to compiled object code, generated documentation,
+ and conversions to other media types.
+
+ "Work" shall mean the work of authorship, whether in Source or
+ Object form, made available under the License, as indicated by a
+ copyright notice that is included in or attached to the work
+ (an example is provided in the Appendix below).
+
+ "Derivative Works" shall mean any work, whether in Source or Object
+ form, that is based on (or derived from) the Work and for which the
+ editorial revisions, annotations, elaborations, or other modifications
+ represent, as a whole, an original work of authorship. For the purposes
+ of this License, Derivative Works shall not include works that remain
+ separable from, or merely link (or bind by name) to the interfaces of,
+ the Work and Derivative Works thereof.
+
+ "Contribution" shall mean any work of authorship, including
+ the original version of the Work and any modifications or additions
+ to that Work or Derivative Works thereof, that is intentionally
+ submitted to Licensor for inclusion in the Work by the copyright owner
+ or by an individual or Legal Entity authorized to submit on behalf of
+ the copyright owner. For the purposes of this definition, "submitted"
+ means any form of electronic, verbal, or written communication sent
+ to the Licensor or its representatives, including but not limited to
+ communication on electronic mailing lists, source code control systems,
+ and issue tracking systems that are managed by, or on behalf of, the
+ Licensor for the purpose of discussing and improving the Work, but
+ excluding communication that is conspicuously marked or otherwise
+ designated in writing by the copyright owner as "Not a Contribution."
+
+ "Contributor" shall mean Licensor and any individual or Legal Entity
+ on behalf of whom a Contribution has been received by Licensor and
+ subsequently incorporated within the Work.
+
+ 2. Grant of Copyright License. Subject to the terms and conditions of
+ this License, each Contributor hereby grants to You a perpetual,
+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+ copyright license to reproduce, prepare Derivative Works of,
+ publicly display, publicly perform, sublicense, and distribute the
+ Work and such Derivative Works in Source or Object form.
+
+ 3. Grant of Patent License. Subject to the terms and conditions of
+ this License, each Contributor hereby grants to You a perpetual,
+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+ (except as stated in this section) patent license to make, have made,
+ use, offer to sell, sell, import, and otherwise transfer the Work,
+ where such license applies only to those patent claims licensable
+ by such Contributor that are necessarily infringed by their
+ Contribution(s) alone or by combination of their Contribution(s)
+ with the Work to which such Contribution(s) was submitted. If You
+ institute patent litigation against any entity (including a
+ cross-claim or counterclaim in a lawsuit) alleging that the Work
+ or a Contribution incorporated within the Work constitutes direct
+ or contributory patent infringement, then any patent licenses
+ granted to You under this License for that Work shall terminate
+ as of the date such litigation is filed.
+
+ 4. Redistribution. You may reproduce and distribute copies of the
+ Work or Derivative Works thereof in any medium, with or without
+ modifications, and in Source or Object form, provided that You
+ meet the following conditions:
+
+ (a) You must give any other recipients of the Work or
+ Derivative Works a copy of this License; and
+
+ (b) You must cause any modified files to carry prominent notices
+ stating that You changed the files; and
+
+ (c) You must retain, in the Source form of any Derivative Works
+ that You distribute, all copyright, patent, trademark, and
+ attribution notices from the Source form of the Work,
+ excluding those notices that do not pertain to any part of
+ the Derivative Works; and
+
+ (d) If the Work includes a "NOTICE" text file as part of its
+ distribution, then any Derivative Works that You distribute must
+ include a readable copy of the attribution notices contained
+ within such NOTICE file, excluding those notices that do not
+ pertain to any part of the Derivative Works, in at least one
+ of the following places: within a NOTICE text file distributed
+ as part of the Derivative Works; within the Source form or
+ documentation, if provided along with the Derivative Works; or,
+ within a display generated by the Derivative Works, if and
+ wherever such third-party notices normally appear. The contents
+ of the NOTICE file are for informational purposes only and
+ do not modify the License. You may add Your own attribution
+ notices within Derivative Works that You distribute, alongside
+ or as an addendum to the NOTICE text from the Work, provided
+ that such additional attribution notices cannot be construed
+ as modifying the License.
+
+ You may add Your own copyright statement to Your modifications and
+ may provide additional or different license terms and conditions
+ for use, reproduction, or distribution of Your modifications, or
+ for any such Derivative Works as a whole, provided Your use,
+ reproduction, and distribution of the Work otherwise complies with
+ the conditions stated in this License.
+
+ 5. Submission of Contributions. Unless You explicitly state otherwise,
+ any Contribution intentionally submitted for inclusion in the Work
+ by You to the Licensor shall be under the terms and conditions of
+ this License, without any additional terms or conditions.
+ Notwithstanding the above, nothing herein shall supersede or modify
+ the terms of any separate license agreement you may have executed
+ with Licensor regarding such Contributions.
+
+ 6. Trademarks. This License does not grant permission to use the trade
+ names, trademarks, service marks, or product names of the Licensor,
+ except as required for reasonable and customary use in describing the
+ origin of the Work and reproducing the content of the NOTICE file.
+
+ 7. Disclaimer of Warranty. Unless required by applicable law or
+ agreed to in writing, Licensor provides the Work (and each
+ Contributor provides its Contributions) on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
+ implied, including, without limitation, any warranties or conditions
+ of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
+ PARTICULAR PURPOSE. You are solely responsible for determining the
+ appropriateness of using or redistributing the Work and assume any
+ risks associated with Your exercise of permissions under this License.
+
+ 8. Limitation of Liability. In no event and under no legal theory,
+ whether in tort (including negligence), contract, or otherwise,
+ unless required by applicable law (such as deliberate and grossly
+ negligent acts) or agreed to in writing, shall any Contributor be
+ liable to You for damages, including any direct, indirect, special,
+ incidental, or consequential damages of any character arising as a
+ result of this License or out of the use or inability to use the
+ Work (including but not limited to damages for loss of goodwill,
+ work stoppage, computer failure or malfunction, or any and all
+ other commercial damages or losses), even if such Contributor
+ has been advised of the possibility of such damages.
+
+ 9. Accepting Warranty or Additional Liability. While redistributing
+ the Work or Derivative Works thereof, You may choose to offer,
+ and charge a fee for, acceptance of support, warranty, indemnity,
+ or other liability obligations and/or rights consistent with this
+ License. However, in accepting such obligations, You may act only
+ on Your own behalf and on Your sole responsibility, not on behalf
+ of any other Contributor, and only if You agree to indemnify,
+ defend, and hold each Contributor harmless for any liability
+ incurred by, or claims asserted against, such Contributor by reason
+ of your accepting any such warranty or additional liability.
+
+ END OF TERMS AND CONDITIONS
+
+ APPENDIX: How to apply the Apache License to your work.
+
+ To apply the Apache License to your work, attach the following
+ boilerplate notice, with the fields enclosed by brackets "[]"
+ replaced with your own identifying information. (Don't include
+ the brackets!) The text should be enclosed in the appropriate
+ comment syntax for the file format. We also recommend that a
+ file or class name and description of purpose be included on the
+ same "printed page" as the copyright notice for easier
+ identification within third-party archives.
+
+ Copyright 2021 Black Square Media Ltd
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
diff --git a/vendor/github.com/bsm/histogram/v3/Makefile b/vendor/github.com/bsm/histogram/v3/Makefile
new file mode 100644
index 000000000..f9073368b
--- /dev/null
+++ b/vendor/github.com/bsm/histogram/v3/Makefile
@@ -0,0 +1,10 @@
+default: test
+
+test:
+ go test ./...
+
+bench:
+ go test ./... -run=NONE -bench=. -benchmem
+
+lint:
+ golangci-lint run
diff --git a/vendor/github.com/bsm/histogram/v3/README.md b/vendor/github.com/bsm/histogram/v3/README.md
new file mode 100644
index 000000000..e52c241fd
--- /dev/null
+++ b/vendor/github.com/bsm/histogram/v3/README.md
@@ -0,0 +1,14 @@
+# Histogram
+
+[![Build Status](https://travis-ci.org/bsm/histogram.svg)](https://travis-ci.org/bsm/histogram) [![GoDoc](https://godoc.org/github.com/bsm/histogram?status.svg)](https://godoc.org/github.com/bsm/histogram)
+
+Fast Go implementation of Ben-Haim's and Yom-Tov's streaming histogram algorithm, as described in their _A Streaming Parallel Decision Tree Algorithm_
+(2010, [PDF](http://jmlr.org/papers/volume11/ben-haim10a/ben-haim10a.pdf)) paper.
+
+## Documentation
+
+Please see the [API documentation](https://godoc.org/github.com/bsm/histogram) for package and API descriptions and examples.
+
+## Credits
+
+- Aaron Windsor - https://github.com/aaw/histosketch (released into the public domain).
diff --git a/vendor/github.com/bsm/histogram/v3/bins.go b/vendor/github.com/bsm/histogram/v3/bins.go
new file mode 100644
index 000000000..41e9e9252
--- /dev/null
+++ b/vendor/github.com/bsm/histogram/v3/bins.go
@@ -0,0 +1,18 @@
+package histogram
+
+import "math"
+
+type bin struct {
+ w float64 // weight
+ v float64 // value
+}
+
+func (b bin) Sum() float64 { return math.Abs(b.w) * b.v }
+
+// ----------------------------------------------------------
+
+type binSlice []bin
+
+func (s binSlice) Len() int { return len(s) }
+func (s binSlice) Less(i, j int) bool { return s[i].v < s[j].v }
+func (s binSlice) Swap(i, j int) { s[i], s[j] = s[j], s[i] }
diff --git a/vendor/github.com/bsm/histogram/v3/histogram.go b/vendor/github.com/bsm/histogram/v3/histogram.go
new file mode 100644
index 000000000..c7c68bf74
--- /dev/null
+++ b/vendor/github.com/bsm/histogram/v3/histogram.go
@@ -0,0 +1,266 @@
+package histogram
+
+import (
+ "math"
+ "sort"
+)
+
+// Histogram is a probabilistic, fixed-size data structure, able to
+// accommodate massive data streams while predicting distributions
+// and quantiles much more accurately than a sample-based approach.
+//
+// Please note that a historgram is not thread-safe. All operations
+// must be protected by a mutex if used across multiple goroutines.
+type Histogram struct {
+ bins []bin
+ size int
+ weight float64
+
+ min, max float64
+}
+
+// New creates a new histogram with a maximum size.
+func New(sz int) *Histogram {
+ h := new(Histogram)
+ h.Reset(sz)
+ return h
+}
+
+// Reset resets the struct to its initial state with
+// a specific size.
+func (h *Histogram) Reset(sz int) {
+ if sz < cap(h.bins) {
+ h.bins = h.bins[:0]
+ } else {
+ h.bins = make([]bin, 0, sz+1)
+ }
+
+ h.size = sz
+ h.min = math.NaN()
+ h.max = math.NaN()
+ h.weight = 0
+}
+
+// Copy copies h to x and returns x. If x is passed as nil
+// a new Histogram will be inited.
+func (h *Histogram) Copy(x *Histogram) *Histogram {
+ if x == nil {
+ x = new(Histogram)
+ }
+ if sz := h.size; sz < cap(x.bins) {
+ x.bins = x.bins[:len(h.bins)]
+ } else {
+ x.bins = make([]bin, len(h.bins), sz+1)
+ }
+ copy(x.bins, h.bins)
+
+ x.size = h.size
+ x.min = h.min
+ x.max = h.max
+ x.weight = h.weight
+ return x
+}
+
+// Count returns the observed weight truncated to the next integer.
+func (h *Histogram) Count() int { return int(h.weight) }
+
+// Weight returns the observed weight (usually, the number of items seen).
+func (h *Histogram) Weight() float64 { return h.weight }
+
+// Min returns the smallest observed value.
+// Returns NaN if Count is zero.
+func (h *Histogram) Min() float64 {
+ if h.weight == 0 {
+ return math.NaN()
+ }
+ return h.min
+}
+
+// Max returns the largest observed value.
+// Returns NaN if Count is zero.
+func (h *Histogram) Max() float64 {
+ if h.weight == 0 {
+ return math.NaN()
+ }
+ return h.max
+}
+
+// Sum returns the (approximate) sum of all observed values.
+// Returns NaN if Count is zero.
+func (h *Histogram) Sum() float64 {
+ if h.weight == 0 {
+ return math.NaN()
+ }
+
+ var sum float64
+ for _, b := range h.bins {
+ sum += b.Sum()
+ }
+ return sum
+}
+
+// Mean returns the (approximate) average observed value.
+// Returns NaN if Count is zero.
+func (h *Histogram) Mean() float64 {
+ if h.weight == 0 {
+ return math.NaN()
+ }
+ return h.Sum() / h.weight
+}
+
+// Variance returns the (approximate) sample variance of the distribution.
+// Returns NaN if Count is zero.
+func (h *Histogram) Variance() float64 {
+ if h.weight <= 1 {
+ return math.NaN()
+ }
+
+ var vv float64
+ mean := h.Mean()
+ for _, b := range h.bins {
+ delta := mean - b.v
+ vv += delta * delta * b.w
+ }
+ return vv / (h.weight - 1)
+}
+
+// Quantile returns the (approximate) quantile of the distribution.
+// Accepted values for q are between 0.0 and 1.0.
+// Returns NaN if Count is zero or bad inputs.
+func (h *Histogram) Quantile(q float64) float64 {
+ if h.weight == 0 || q < 0.0 || q > 1.0 {
+ return math.NaN()
+ } else if q == 0.0 {
+ return h.min
+ } else if q == 1.0 {
+ return h.max
+ }
+
+ delta := q * h.weight
+ pos := 0
+ for w0 := 0.0; pos < len(h.bins); pos++ {
+ w1 := math.Abs(h.bins[pos].w) / 2.0
+ if delta-w1-w0 < 0 {
+ break
+ }
+ delta -= (w1 + w0)
+ w0 = w1
+ }
+
+ switch pos {
+ case 0: // lower bound
+ return h.solve(bin{v: h.min, w: 0}, h.bins[pos], delta)
+ case len(h.bins): // upper bound
+ return h.solve(h.bins[pos-1], bin{v: h.max, w: 0}, delta)
+ default:
+ return h.solve(h.bins[pos-1], h.bins[pos], delta)
+ }
+}
+
+// Add is the same as AddWeight(v, 1)
+func (h *Histogram) Add(v float64) { h.AddWeight(v, 1) }
+
+// AddN is the same as AddWeight(v, float64(n))
+func (h *Histogram) AddN(v float64, n int) { h.AddWeight(v, float64(n)) }
+
+// AddWeight adds observations of v with the weight w to the distribution.
+func (h *Histogram) AddWeight(v, w float64) {
+ if w <= 0 {
+ return
+ }
+ if h.weight == 0 || v < h.min {
+ h.min = v
+ }
+ if h.weight == 0 || v > h.max {
+ h.max = v
+ }
+
+ h.insert(v, w)
+ h.weight += w
+
+ h.prune()
+}
+
+// Merge sets h to the union x ∪ y.
+func (h *Histogram) Merge(x, y *Histogram) {
+ h.bins = append(h.bins[:0], x.bins...)
+ h.bins = append(h.bins, y.bins...)
+ sort.Sort(binSlice(h.bins))
+ h.prune()
+}
+
+// MergeWith sets h to the union h ∪ x.
+func (h *Histogram) MergeWith(x *Histogram) { h.Merge(h, x) }
+
+// NumBins returns bin (bucket) count.
+func (h *Histogram) NumBins() int { return len(h.bins) }
+
+// Bin returns bin (bucket) data.
+// Requested index must be 0 <= i < NumBins() or it will panic.
+func (h *Histogram) Bin(i int) (value, weight float64) {
+ b := h.bins[i]
+ return b.v, b.w
+}
+
+func (h *Histogram) solve(b1, b2 bin, delta float64) float64 {
+ w1, w2 := b1.w, b2.w
+
+ // return if both bins are exact (unmerged)
+ if w1 > 0 && w2 > 0 {
+ return b2.v
+ }
+
+ // normalise
+ w1, w2 = math.Abs(w1), math.Abs(w2)
+
+ // calculate multiplier
+ var z float64
+ if w1 == w2 {
+ z = delta / w1
+ } else {
+ a := 2 * (w2 - w1)
+ b := 2 * w1
+ z = (math.Sqrt(b*b+4*a*delta) - b) / a
+ }
+ return b1.v + (b2.v-b1.v)*z
+}
+
+func (h *Histogram) insert(v, w float64) {
+ pos := h.search(v)
+ if pos < len(h.bins) && h.bins[pos].v == v {
+ h.bins[pos].w += math.Copysign(w, h.bins[pos].w)
+ return
+ }
+
+ maxi := len(h.bins)
+ h.bins = h.bins[:len(h.bins)+1]
+ if pos != maxi {
+ copy(h.bins[pos+1:], h.bins[pos:])
+ }
+ h.bins[pos].w = w
+ h.bins[pos].v = v
+}
+
+func (h *Histogram) prune() {
+ for len(h.bins) > h.size {
+ delta := math.MaxFloat64
+ pos := 0
+ for i := 0; i < len(h.bins)-1; i++ {
+ b1, b2 := h.bins[i], h.bins[i+1]
+ if x := b2.v - b1.v; x < delta {
+ pos, delta = i, x
+ }
+ }
+
+ b1, b2 := h.bins[pos], h.bins[pos+1]
+ w := math.Abs(b1.w) + math.Abs(b2.w)
+ v := (b1.Sum() + b2.Sum()) / w
+ h.bins[pos+1].w = -w
+ h.bins[pos+1].v = v
+ h.bins = h.bins[:pos+copy(h.bins[pos:], h.bins[pos+1:])]
+ }
+}
+
+func (h *Histogram) search(v float64) int {
+ return sort.Search(len(h.bins), func(i int) bool { return h.bins[i].v >= v })
+}